C19H26ClN3O5S — CID 22856296
(2R)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide;hydrochloride (PubChem CID 22856296) has the molecular formula C19H26ClN3O5S and a molecular weight of 443.95 g/mol. Its IUPAC name is (2R)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide;hydrochloride.
| Compound Name | (2R)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 22856296 |
| Molecular Formula | C19H26ClN3O5S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (2R)-2-[(4-ethoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-N-hydroxy-3-methylbutanamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N(Cc2cccnc2)[C@@H](C(=O)NO)C(C)C)cc1.Cl |
| InChI | InChI=1S/C19H25N3O5S.ClH/c1-4-27-16-7-9-17(10-8-16)28(25,26)22(13-15-6-5-11-20-12-15)18(14(2)3)19(23)21-24;/h5-12,14,18,24H,4,13H2,1-3H3,(H,21,23);1H/t18-;/m1./s1 |
| InChIKey | DURGUOKVILMXQM-GMUIIQOCSA-N |
| XLogP | 2.62 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|