C26H31N3O6S — CID 22859998
(2R)-N-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide (PubChem CID 22859998) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is (2R)-N-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide.
| Compound Name | (2R)-N-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 22859998 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (2R)-N-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
| SMILES | COc1ccc(CONC(=O)[C@@H](C(C)C)N(Cc2cccnc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O6S/c1-19(2)25(26(30)28-35-18-20-7-9-22(33-3)10-8-20)29(17-21-6-5-15-27-16-21)36(31,32)24-13-11-23(34-4)12-14-24/h5-16,19,25H,17-18H2,1-4H3,(H,28,30)/t25-/m1/s1 |
| InChIKey | ZINBLZNUXBGZRW-RUZDIDTESA-N |
| XLogP | 3.56 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|