C25H34N2O7S — CID 25180862
tert-butyl 2-[(4-methoxyphenyl)sulfonyl-[(2R)-3-methyl-1-oxo-1-(phenylmethoxyamino)butan-2-yl]amino]acetate (PubChem CID 25180862) has the molecular formula C25H34N2O7S and a molecular weight of 506.62 g/mol. Its IUPAC name is tert-butyl 2-[(4-methoxyphenyl)sulfonyl-[(2R)-3-methyl-1-oxo-1-(phenylmethoxyamino)butan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(4-methoxyphenyl)sulfonyl-[(2R)-3-methyl-1-oxo-1-(phenylmethoxyamino)butan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 25180862 |
| Molecular Formula | C25H34N2O7S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | tert-butyl 2-[(4-methoxyphenyl)sulfonyl-[(2R)-3-methyl-1-oxo-1-(phenylmethoxyamino)butan-2-yl]amino]acetate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)OC(C)(C)C)[C@@H](C(=O)NOCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C25H34N2O7S/c1-18(2)23(24(29)26-33-17-19-10-8-7-9-11-19)27(16-22(28)34-25(3,4)5)35(30,31)21-14-12-20(32-6)13-15-21/h7-15,18,23H,16-17H2,1-6H3,(H,26,29)/t23-/m1/s1 |
| InChIKey | WGEGTSBLFMHABN-HSZRJFAPSA-N |
| XLogP | 3.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|