C24H31NO7S2 — CID 70063539
4-benzylsulfanyl-2-[(4-methoxyphenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid (PubChem CID 70063539) has the molecular formula C24H31NO7S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-benzylsulfanyl-2-[(4-methoxyphenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid.
| Compound Name | 4-benzylsulfanyl-2-[(4-methoxyphenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70063539 |
| Molecular Formula | C24H31NO7S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 4-benzylsulfanyl-2-[(4-methoxyphenyl)sulfonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)OC(C)(C)C)C(CCSCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H31NO7S2/c1-24(2,3)32-22(26)16-25(34(29,30)20-12-10-19(31-4)11-13-20)21(23(27)28)14-15-33-17-18-8-6-5-7-9-18/h5-13,21H,14-17H2,1-4H3,(H,27,28) |
| InChIKey | VTEVRUYYZRWAOC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|