C25H27ClN2O4S2 — CID 30228980
N-(3-benzylsulfanylpropyl)-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide (PubChem CID 30228980) has the molecular formula C25H27ClN2O4S2 and a molecular weight of 519.09 g/mol. Its IUPAC name is N-(3-benzylsulfanylpropyl)-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3-benzylsulfanylpropyl)-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30228980 |
| Molecular Formula | C25H27ClN2O4S2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-(3-benzylsulfanylpropyl)-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN2O4S2/c1-32-23-12-14-24(15-13-23)34(30,31)28(22-10-8-21(26)9-11-22)18-25(29)27-16-5-17-33-19-20-6-3-2-4-7-20/h2-4,6-15H,5,16-19H2,1H3,(H,27,29) |
| InChIKey | IPQACLCKBJGMJC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|