C30H29ClN2O4S2 — CID 5200887
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide (PubChem CID 5200887) has the molecular formula C30H29ClN2O4S2 and a molecular weight of 581.16 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 5200887 |
| Molecular Formula | C30H29ClN2O4S2 |
| Molecular Weight | 581.16 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccc(Cl)cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29ClN2O4S2/c1-23-7-17-29(18-8-23)39(35,36)33(26-13-15-28(16-14-26)37-27-5-3-2-4-6-27)21-30(34)32-19-20-38-22-24-9-11-25(31)12-10-24/h2-18H,19-22H2,1H3,(H,32,34) |
| InChIKey | ZOERMOZDPKGPJF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.16 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|