C25H26Cl2N2O4S2 — CID 126031312
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126031312) has the molecular formula C25H26Cl2N2O4S2 and a molecular weight of 553.53 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126031312 |
| Molecular Formula | C25H26Cl2N2O4S2 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSCc2c(Cl)cccc2Cl)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O4S2/c1-18-6-12-21(13-7-18)35(31,32)29(19-8-10-20(33-2)11-9-19)16-25(30)28-14-15-34-17-22-23(26)4-3-5-24(22)27/h3-13H,14-17H2,1-2H3,(H,28,30) |
| InChIKey | NOWKXECWLJCBQS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|