C22H28O5S — CID 18790103
3-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-7-phenylheptanoic acid (PubChem CID 18790103) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-7-phenylheptanoic acid.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 18790103 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-7-phenylheptanoic acid |
| SMILES | COc1ccc(S(=O)(=O)C(CCCCc2ccccc2)C(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C22H28O5S/c1-22(2,21(23)24)20(12-8-7-11-17-9-5-4-6-10-17)28(25,26)19-15-13-18(27-3)14-16-19/h4-6,9-10,13-16,20H,7-8,11-12H2,1-3H3,(H,23,24) |
| InChIKey | KTQWEAQXKFYSMU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|