C19H24O — CID 54077830
1-methoxy-4-(6-phenylhexyl)benzene (PubChem CID 54077830) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-methoxy-4-(6-phenylhexyl)benzene.
| Compound Name | 1-methoxy-4-(6-phenylhexyl)benzene |
|---|---|
| PubChem CID | 54077830 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-methoxy-4-(6-phenylhexyl)benzene |
| SMILES | COc1ccc(CCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24O/c1-20-19-15-13-18(14-16-19)12-6-3-2-5-9-17-10-7-4-8-11-17/h4,7-8,10-11,13-16H,2-3,5-6,9,12H2,1H3 |
| InChIKey | FHLKPZDBEPKKFC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|