C51H48N6O9 — CID 167563213
2-(4-hexylphenoxy)-4,6-diphenoxy-1,3,5-triazine;2,4,6-tris(4-methoxyphenoxy)-1,3,5-triazine (PubChem CID 167563213) has the molecular formula C51H48N6O9 and a molecular weight of 888.98 g/mol. Its IUPAC name is 2-(4-hexylphenoxy)-4,6-diphenoxy-1,3,5-triazine;2,4,6-tris(4-methoxyphenoxy)-1,3,5-triazine.
| Compound Name | 2-(4-hexylphenoxy)-4,6-diphenoxy-1,3,5-triazine;2,4,6-tris(4-methoxyphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 167563213 |
| Molecular Formula | C51H48N6O9 |
| Molecular Weight | 888.98 g/mol |
| Exact Mass | 888.35 |
| IUPAC Name | 2-(4-hexylphenoxy)-4,6-diphenoxy-1,3,5-triazine;2,4,6-tris(4-methoxyphenoxy)-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(Oc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1.COc1ccc(Oc2nc(Oc3ccc(OC)cc3)nc(Oc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C27H27N3O3.C24H21N3O6/c1-2-3-4-7-12-21-17-19-24(20-18-21)33-27-29-25(31-22-13-8-5-9-14-22)28-26(30-27)32-23-15-10-6-11-16-23;1-28-16-4-10-19(11-5-16)31-22-25-23(32-20-12-6-17(29-2)7-13-20)27-24(26-22)33-21-14-8-18(30-3)9-15-21/h5-6,8-11,13-20H,2-4,7,12H2,1H3;4-15H,1-3H3 |
| InChIKey | DXYVOBNIUJSUTP-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 160.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.98 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|