About (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone
(4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone (PubChem CID 67686863) has the molecular formula C35H38O3
and a molecular weight of 506.69 g/mol. Its IUPAC name is (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone |
| PubChem CID | 67686863 |
| Molecular Formula | C35H38O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone |
| SMILES | CCCCCCCCc1ccc(C(=O)c2ccccc2)cc1.COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26O.C14H12O2/c1-2-3-4-5-6-8-11-18-14-16-20(17-15-18)21(22)19-12-9-7-10-13-19;1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h7,9-10,12-17H,2-6,8,11H2,1H3;2-10H,1H3 |
| InChIKey | VXKKGBQVPPIFTN-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone?
The IUPAC name of (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone (CID 67686863) is (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone.
What is the SMILES notation for (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone?
The canonical SMILES for (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone is CCCCCCCCc1ccc(C(=O)c2ccccc2)cc1.COc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone?
The InChIKey is VXKKGBQVPPIFTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O.C14H12O2/c1-2-3-4-5-6-8-11-18-14-16-20(17-15-18)21(22)19-12-9-7-10-13-19;1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h7,9-10,12-17H,2-6,8,11H2,1H3;2-10H,1H3.
What are the key properties of (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone?
(4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone has a molecular weight of 506.69 g/mol, XLogP of 8.75, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-phenylmethanone;(4-octylphenyl)-phenylmethanone is sourced from PubChem (CID 67686863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).