C19H22O6S — CID 18416928
2-(4-methoxyphenyl)sulfonyl-6-phenoxyhexanoic acid (PubChem CID 18416928) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-6-phenoxyhexanoic acid.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-6-phenoxyhexanoic acid |
|---|---|
| PubChem CID | 18416928 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-6-phenoxyhexanoic acid |
| SMILES | COc1ccc(S(=O)(=O)C(CCCCOc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H22O6S/c1-24-15-10-12-17(13-11-15)26(22,23)18(19(20)21)9-5-6-14-25-16-7-3-2-4-8-16/h2-4,7-8,10-13,18H,5-6,9,14H2,1H3,(H,20,21) |
| InChIKey | CRWKHOSIPSVVGS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|