C22H28O4S — CID 23047834
2-(benzenesulfonyl)-10-phenyldecanoic acid (PubChem CID 23047834) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-10-phenyldecanoic acid.
| Compound Name | 2-(benzenesulfonyl)-10-phenyldecanoic acid |
|---|---|
| PubChem CID | 23047834 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(benzenesulfonyl)-10-phenyldecanoic acid |
| SMILES | O=C(O)C(CCCCCCCCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4S/c23-22(24)21(27(25,26)20-16-10-6-11-17-20)18-12-4-2-1-3-7-13-19-14-8-5-9-15-19/h5-6,8-11,14-17,21H,1-4,7,12-13,18H2,(H,23,24) |
| InChIKey | XYCCZKQRYOZKNV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|