C19H22O5S — CID 19878738
2-(4-methylphenyl)sulfonyl-4-(2-phenylethoxy)butanoic acid (PubChem CID 19878738) has the molecular formula C19H22O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4-(2-phenylethoxy)butanoic acid.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4-(2-phenylethoxy)butanoic acid |
|---|---|
| PubChem CID | 19878738 |
| Molecular Formula | C19H22O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4-(2-phenylethoxy)butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)C(CCOCCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H22O5S/c1-15-7-9-17(10-8-15)25(22,23)18(19(20)21)12-14-24-13-11-16-5-3-2-4-6-16/h2-10,18H,11-14H2,1H3,(H,20,21) |
| InChIKey | IEHSUBIVCMDIML-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|