C16H24O6S2 — CID 23181813
2-(4-methylphenyl)sulfonyl-8-methylsulfonyloctanoic acid (PubChem CID 23181813) has the molecular formula C16H24O6S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-8-methylsulfonyloctanoic acid.
| Compound Name | 2-(4-methylphenyl)sulfonyl-8-methylsulfonyloctanoic acid |
|---|---|
| PubChem CID | 23181813 |
| Molecular Formula | C16H24O6S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-8-methylsulfonyloctanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)C(CCCCCCS(C)(=O)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H24O6S2/c1-13-8-10-14(11-9-13)24(21,22)15(16(17)18)7-5-3-4-6-12-23(2,19)20/h8-11,15H,3-7,12H2,1-2H3,(H,17,18) |
| InChIKey | JANYRWHTCUQOGH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|