C20H23ClO4S — CID 23047702
7-(3-chlorophenyl)-2-(4-methylphenyl)sulfonylheptanoic acid (PubChem CID 23047702) has the molecular formula C20H23ClO4S and a molecular weight of 394.92 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-2-(4-methylphenyl)sulfonylheptanoic acid.
| Compound Name | 7-(3-chlorophenyl)-2-(4-methylphenyl)sulfonylheptanoic acid |
|---|---|
| PubChem CID | 23047702 |
| Molecular Formula | C20H23ClO4S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 7-(3-chlorophenyl)-2-(4-methylphenyl)sulfonylheptanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)C(CCCCCc2cccc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23ClO4S/c1-15-10-12-18(13-11-15)26(24,25)19(20(22)23)9-4-2-3-6-16-7-5-8-17(21)14-16/h5,7-8,10-14,19H,2-4,6,9H2,1H3,(H,22,23) |
| InChIKey | DDHMWRCNYKFKIN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|