C19H22F2O4S2 — CID 59750767
1,4-difluoro-2-[1-(4-methylphenyl)sulfonyl-5-methylsulfonylpentyl]benzene (PubChem CID 59750767) has the molecular formula C19H22F2O4S2 and a molecular weight of 416.51 g/mol. Its IUPAC name is 1,4-difluoro-2-[1-(4-methylphenyl)sulfonyl-5-methylsulfonylpentyl]benzene.
| Compound Name | 1,4-difluoro-2-[1-(4-methylphenyl)sulfonyl-5-methylsulfonylpentyl]benzene |
|---|---|
| PubChem CID | 59750767 |
| Molecular Formula | C19H22F2O4S2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1,4-difluoro-2-[1-(4-methylphenyl)sulfonyl-5-methylsulfonylpentyl]benzene |
| SMILES | Cc1ccc(S(=O)(=O)C(CCCCS(C)(=O)=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C19H22F2O4S2/c1-14-6-9-16(10-7-14)27(24,25)19(5-3-4-12-26(2,22)23)17-13-15(20)8-11-18(17)21/h6-11,13,19H,3-5,12H2,1-2H3 |
| InChIKey | JESNNXKKMPBPHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|