C19H23ClO5S2 — CID 59750724
[2-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]phenyl]methanol (PubChem CID 59750724) has the molecular formula C19H23ClO5S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]phenyl]methanol.
| Compound Name | [2-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]phenyl]methanol |
|---|---|
| PubChem CID | 59750724 |
| Molecular Formula | C19H23ClO5S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [2-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]phenyl]methanol |
| SMILES | CS(=O)(=O)CCCCC(c1ccccc1CO)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO5S2/c1-26(22,23)13-5-4-8-19(18-7-3-2-6-15(18)14-21)27(24,25)17-11-9-16(20)10-12-17/h2-3,6-7,9-12,19,21H,4-5,8,13-14H2,1H3 |
| InChIKey | FDYPJTOMIHIDLQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|