C19H23ClO5S2 — CID 59750762
1-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]-3-methoxybenzene (PubChem CID 59750762) has the molecular formula C19H23ClO5S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]-3-methoxybenzene.
| Compound Name | 1-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 59750762 |
| Molecular Formula | C19H23ClO5S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]-3-methoxybenzene |
| SMILES | COc1cccc(C(CCCCS(C)(=O)=O)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H23ClO5S2/c1-25-17-7-5-6-15(14-17)19(8-3-4-13-26(2,21)22)27(23,24)18-11-9-16(20)10-12-18/h5-7,9-12,14,19H,3-4,8,13H2,1-2H3 |
| InChIKey | LDSCITWUPSBJBR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|