C15H17ClNO3S+ — CID 9167400
[(2S)-2-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)ethyl]azanium (PubChem CID 9167400) has the molecular formula C15H17ClNO3S+ and a molecular weight of 326.83 g/mol. Its IUPAC name is [(2S)-2-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)ethyl]azanium.
| Compound Name | [(2S)-2-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9167400 |
| Molecular Formula | C15H17ClNO3S+ |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | [(2S)-2-(4-chlorophenyl)sulfonyl-2-(3-methoxyphenyl)ethyl]azanium |
| SMILES | COc1cccc([C@@H](C[NH3+])S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H16ClNO3S/c1-20-13-4-2-3-11(9-13)15(10-17)21(18,19)14-7-5-12(16)6-8-14/h2-9,15H,10,17H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | GKSXDPBVCNQTDW-OAHLLOKOSA-O |
| XLogP | 2.11 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |