C16H18NO5S+ — CID 9167644
[(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)sulfonylethyl]azanium (PubChem CID 9167644) has the molecular formula C16H18NO5S+ and a molecular weight of 336.39 g/mol. Its IUPAC name is [(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)sulfonylethyl]azanium.
| Compound Name | [(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)sulfonylethyl]azanium |
|---|---|
| PubChem CID | 9167644 |
| Molecular Formula | C16H18NO5S+ |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [(2S)-2-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)sulfonylethyl]azanium |
| SMILES | COc1ccc(S(=O)(=O)[C@H](C[NH3+])c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H17NO5S/c1-20-12-3-5-13(6-4-12)23(18,19)16(9-17)11-2-7-14-15(8-11)22-10-21-14/h2-8,16H,9-10,17H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | UJCUVRLBQDVYBR-MRXNPFEDSA-O |
| XLogP | 1.18 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |