C16H17NO4 — CID 43211655
2-(1,3-benzodioxol-5-yloxy)-1-(4-methoxyphenyl)ethanamine (PubChem CID 43211655) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-(4-methoxyphenyl)ethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 43211655 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(N)COc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-18-12-4-2-11(3-5-12)14(17)9-19-13-6-7-15-16(8-13)21-10-20-15/h2-8,14H,9-10,17H2,1H3 |
| InChIKey | XPCVCJRNKSMSBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |