C14H19NO3 — CID 104748816
2-(1,3-benzodioxol-5-yloxy)-1-cyclopentylethanamine (PubChem CID 104748816) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-cyclopentylethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-cyclopentylethanamine |
|---|---|
| PubChem CID | 104748816 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-cyclopentylethanamine |
| SMILES | NC(COc1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C14H19NO3/c15-12(10-3-1-2-4-10)8-16-11-5-6-13-14(7-11)18-9-17-13/h5-7,10,12H,1-4,8-9,15H2 |
| InChIKey | WARAZOQDPUMLBD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |