C17H19NO3 — CID 105350223
2-[4-(1,3-benzodioxol-5-yloxymethyl)phenyl]propan-1-amine (PubChem CID 105350223) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yloxymethyl)phenyl]propan-1-amine.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yloxymethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 105350223 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yloxymethyl)phenyl]propan-1-amine |
| SMILES | CC(CN)c1ccc(COc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-12(9-18)14-4-2-13(3-5-14)10-19-15-6-7-16-17(8-15)21-11-20-16/h2-8,12H,9-11,18H2,1H3 |
| InChIKey | RSPVLTQTDYPWQQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |