C13H13N3O3 — CID 55051241
[5-(1,3-benzodioxol-5-yloxymethyl)-2-pyridinyl]hydrazine (PubChem CID 55051241) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-yloxymethyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-(1,3-benzodioxol-5-yloxymethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 55051241 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [5-(1,3-benzodioxol-5-yloxymethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(COc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C13H13N3O3/c14-16-13-4-1-9(6-15-13)7-17-10-2-3-11-12(5-10)19-8-18-11/h1-6H,7-8,14H2,(H,15,16) |
| InChIKey | XWBKSGOQNXNWIO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|