C15H16N2O3 — CID 83127599
(1S)-1-[5-(1,3-benzodioxol-5-ylmethoxy)-2-pyridinyl]ethanamine (PubChem CID 83127599) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1S)-1-[5-(1,3-benzodioxol-5-ylmethoxy)-2-pyridinyl]ethanamine.
| Compound Name | (1S)-1-[5-(1,3-benzodioxol-5-ylmethoxy)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 83127599 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (1S)-1-[5-(1,3-benzodioxol-5-ylmethoxy)-2-pyridinyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(OCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C15H16N2O3/c1-10(16)13-4-3-12(7-17-13)18-8-11-2-5-14-15(6-11)20-9-19-14/h2-7,10H,8-9,16H2,1H3/t10-/m0/s1 |
| InChIKey | YAHJNFLSPKCUNA-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |