C26H30N2O4 — CID 19050339
5-(1,3-benzodioxol-5-ylmethoxy)-2-(4-octoxyphenyl)pyrimidine (PubChem CID 19050339) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethoxy)-2-(4-octoxyphenyl)pyrimidine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethoxy)-2-(4-octoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 19050339 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethoxy)-2-(4-octoxyphenyl)pyrimidine |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(OCc3ccc4c(c3)OCO4)cn2)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-2-3-4-5-6-7-14-29-22-11-9-21(10-12-22)26-27-16-23(17-28-26)30-18-20-8-13-24-25(15-20)32-19-31-24/h8-13,15-17H,2-7,14,18-19H2,1H3 |
| InChIKey | HIYUFNDYGSUUGR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|