C25H28N2O2 — CID 139652750
2-(1,3-benzodioxol-5-yl)-5-(4-octylphenyl)pyrimidine (PubChem CID 139652750) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-(4-octylphenyl)pyrimidine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-(4-octylphenyl)pyrimidine |
|---|---|
| PubChem CID | 139652750 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-(4-octylphenyl)pyrimidine |
| SMILES | CCCCCCCCc1ccc(-c2cnc(-c3ccc4c(c3)OCO4)nc2)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-2-3-4-5-6-7-8-19-9-11-20(12-10-19)22-16-26-25(27-17-22)21-13-14-23-24(15-21)29-18-28-23/h9-17H,2-8,18H2,1H3 |
| InChIKey | QBYCQGWWJBSFKN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|