C31H40N2O2 — CID 19050398
2-(2-heptyl-1,3-benzodioxol-5-yl)-5-(4-heptylphenyl)pyrimidine (PubChem CID 19050398) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is 2-(2-heptyl-1,3-benzodioxol-5-yl)-5-(4-heptylphenyl)pyrimidine.
| Compound Name | 2-(2-heptyl-1,3-benzodioxol-5-yl)-5-(4-heptylphenyl)pyrimidine |
|---|---|
| PubChem CID | 19050398 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 2-(2-heptyl-1,3-benzodioxol-5-yl)-5-(4-heptylphenyl)pyrimidine |
| SMILES | CCCCCCCc1ccc(-c2cnc(-c3ccc4c(c3)OC(CCCCCCC)O4)nc2)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-3-5-7-9-11-13-24-15-17-25(18-16-24)27-22-32-31(33-23-27)26-19-20-28-29(21-26)35-30(34-28)14-12-10-8-6-4-2/h15-23,30H,3-14H2,1-2H3 |
| InChIKey | NSNUVKLGOCCISS-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|