C13H13N3O3 — CID 66450197
[6-(1,3-benzodioxol-5-ylmethoxy)pyrazin-2-yl]methanamine (PubChem CID 66450197) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-ylmethoxy)pyrazin-2-yl]methanamine.
| Compound Name | [6-(1,3-benzodioxol-5-ylmethoxy)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 66450197 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [6-(1,3-benzodioxol-5-ylmethoxy)pyrazin-2-yl]methanamine |
| SMILES | NCc1cncc(OCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H13N3O3/c14-4-10-5-15-6-13(16-10)17-7-9-1-2-11-12(3-9)19-8-18-11/h1-3,5-6H,4,7-8,14H2 |
| InChIKey | DAHZSAVYXWVFPK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |