C13H13N3O3 — CID 80859608
6-(1,3-benzodioxol-5-ylmethoxy)-N-methylpyrazin-2-amine (PubChem CID 80859608) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethoxy)-N-methylpyrazin-2-amine.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethoxy)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 80859608 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethoxy)-N-methylpyrazin-2-amine |
| SMILES | CNc1cncc(OCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-14-12-5-15-6-13(16-12)17-7-9-2-3-10-11(4-9)19-8-18-10/h2-6H,7-8H2,1H3,(H,14,16) |
| InChIKey | PWEQAWBEULOQOW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |