C15H14N2O3S — CID 114768074
2-(1,3-benzodioxol-5-ylmethoxy)-6-methylpyridine-4-carbothioamide (PubChem CID 114768074) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114768074 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(OCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C15H14N2O3S/c1-9-4-11(15(16)21)6-14(17-9)18-7-10-2-3-12-13(5-10)20-8-19-12/h2-6H,7-8H2,1H3,(H2,16,21) |
| InChIKey | SNYANAISJGXFAY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|