C15H13NO3S — CID 28602236
2-(1,3-benzodioxol-5-ylmethoxy)benzenecarbothioamide (PubChem CID 28602236) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)benzenecarbothioamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 28602236 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13NO3S/c16-15(20)11-3-1-2-4-12(11)17-8-10-5-6-13-14(7-10)19-9-18-13/h1-7H,8-9H2,(H2,16,20) |
| InChIKey | XQUFNJJNIBQBQG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|