C16H17NO4 — CID 66515700
(2S)-2-amino-2-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]ethanol (PubChem CID 66515700) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]ethanol.
| Compound Name | (2S)-2-amino-2-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 66515700 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (2S)-2-amino-2-[2-(1,3-benzodioxol-5-ylmethoxy)phenyl]ethanol |
| SMILES | N[C@H](CO)c1ccccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17NO4/c17-13(8-18)12-3-1-2-4-14(12)19-9-11-5-6-15-16(7-11)21-10-20-15/h1-7,13,18H,8-10,17H2/t13-/m1/s1 |
| InChIKey | FWYANHKDCVHFJJ-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |