C10H14ClNO3 — CID 170893090
2-amino-3-(1,3-benzodioxol-5-yl)propan-1-ol;hydrochloride (PubChem CID 170893090) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzodioxol-5-yl)propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-(1,3-benzodioxol-5-yl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170893090 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-amino-3-(1,3-benzodioxol-5-yl)propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO3.ClH/c11-8(5-12)3-7-1-2-9-10(4-7)14-6-13-9;/h1-2,4,8,12H,3,5-6,11H2;1H |
| InChIKey | OJDYCLQALFBHRO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |