C10H12ClNO3 — CID 131351020
2-amino-3-(6-chloro-1,3-benzodioxol-5-yl)propan-1-ol (PubChem CID 131351020) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-amino-3-(6-chloro-1,3-benzodioxol-5-yl)propan-1-ol.
| Compound Name | 2-amino-3-(6-chloro-1,3-benzodioxol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 131351020 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-amino-3-(6-chloro-1,3-benzodioxol-5-yl)propan-1-ol |
| SMILES | NC(CO)Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H12ClNO3/c11-8-3-10-9(14-5-15-10)2-6(8)1-7(12)4-13/h2-3,7,13H,1,4-5,12H2 |
| InChIKey | DWVQNTIPJYHOGR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |