C14H15ClO5 — CID 70461188
ethyl 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-oxobutanoate (PubChem CID 70461188) has the molecular formula C14H15ClO5 and a molecular weight of 298.72 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 70461188 |
| Molecular Formula | C14H15ClO5 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | ethyl 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1cc2c(cc1Cl)OCO2)C(C)=O |
| InChI | InChI=1S/C14H15ClO5/c1-3-18-14(17)10(8(2)16)4-9-5-12-13(6-11(9)15)20-7-19-12/h5-6,10H,3-4,7H2,1-2H3 |
| InChIKey | ZNHXHNZXUNPTGE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|