C13H15Cl2NO4 — CID 116519757
diethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]propanedioate (PubChem CID 116519757) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is diethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]propanedioate |
|---|---|
| PubChem CID | 116519757 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | diethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cnc(Cl)cc1Cl)C(=O)OCC |
| InChI | InChI=1S/C13H15Cl2NO4/c1-3-19-12(17)9(13(18)20-4-2)5-8-7-16-11(15)6-10(8)14/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | IRLUQTNLMHQNKD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|