C11H10Br2FNO4 — CID 145019296
1-O-ethyl 3-O-fluoro 2-[(2,5-dibromo-3-pyridinyl)methyl]propanedioate (PubChem CID 145019296) has the molecular formula C11H10Br2FNO4 and a molecular weight of 399.01 g/mol. Its IUPAC name is 1-O-ethyl 3-O-fluoro 2-[(2,5-dibromo-3-pyridinyl)methyl]propanedioate.
| Compound Name | 1-O-ethyl 3-O-fluoro 2-[(2,5-dibromo-3-pyridinyl)methyl]propanedioate |
|---|---|
| PubChem CID | 145019296 |
| Molecular Formula | C11H10Br2FNO4 |
| Molecular Weight | 399.01 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 1-O-ethyl 3-O-fluoro 2-[(2,5-dibromo-3-pyridinyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cc(Br)cnc1Br)C(=O)OF |
| InChI | InChI=1S/C11H10Br2FNO4/c1-2-18-10(16)8(11(17)19-14)4-6-3-7(12)5-15-9(6)13/h3,5,8H,2,4H2,1H3 |
| InChIKey | MIVXNSYGWZPFPY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.01 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|