C11H16N2O4S — CID 54568864
diethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl]propanedioate (PubChem CID 54568864) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is diethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 54568864 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | diethyl 2-[(2-amino-1,3-thiazol-5-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cnc(N)s1)C(=O)OCC |
| InChI | InChI=1S/C11H16N2O4S/c1-3-16-9(14)8(10(15)17-4-2)5-7-6-13-11(12)18-7/h6,8H,3-5H2,1-2H3,(H2,12,13) |
| InChIKey | ZVURBCFDXXIGSV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|