C14H21NO4S — CID 103972703
dipropan-2-yl 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propanedioate (PubChem CID 103972703) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is dipropan-2-yl 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propanedioate.
| Compound Name | dipropan-2-yl 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 103972703 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | dipropan-2-yl 2-[(2-methyl-1,3-thiazol-5-yl)methyl]propanedioate |
| SMILES | Cc1ncc(CC(C(=O)OC(C)C)C(=O)OC(C)C)s1 |
| InChI | InChI=1S/C14H21NO4S/c1-8(2)18-13(16)12(14(17)19-9(3)4)6-11-7-15-10(5)20-11/h7-9,12H,6H2,1-5H3 |
| InChIKey | NSPLFIUBLJFRDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|