C13H19NO4S — CID 103972762
dipropan-2-yl 2-(1,3-thiazol-2-ylmethyl)propanedioate (PubChem CID 103972762) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is dipropan-2-yl 2-(1,3-thiazol-2-ylmethyl)propanedioate.
| Compound Name | dipropan-2-yl 2-(1,3-thiazol-2-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 103972762 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | dipropan-2-yl 2-(1,3-thiazol-2-ylmethyl)propanedioate |
| SMILES | CC(C)OC(=O)C(Cc1nccs1)C(=O)OC(C)C |
| InChI | InChI=1S/C13H19NO4S/c1-8(2)17-12(15)10(13(16)18-9(3)4)7-11-14-5-6-19-11/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | KRSYCTCADLLXKP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|