C9H15NOS2 — CID 79825227
1-propan-2-ylsulfanyl-3-(1,3-thiazol-2-yl)propan-2-ol (PubChem CID 79825227) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-propan-2-ylsulfanyl-3-(1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1-propan-2-ylsulfanyl-3-(1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79825227 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-propan-2-ylsulfanyl-3-(1,3-thiazol-2-yl)propan-2-ol |
| SMILES | CC(C)SCC(O)Cc1nccs1 |
| InChI | InChI=1S/C9H15NOS2/c1-7(2)13-6-8(11)5-9-10-3-4-12-9/h3-4,7-8,11H,5-6H2,1-2H3 |
| InChIKey | CXULLSURGRIVIH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |