2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide

C8H13NO2S2 — CID 175140576

IUPAC2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide
SMILESCC[C@@H](C)Cc1nccs1.O=S=O
InChIInChI=1S/C8H13NS.O2S/c1-3-7(2)6-8-9-4-5-10-8;1-3-2/h4-5,7H,3,6H2,1-2H3;/t7-;/m1./s1
InChIKeyZZWFLGIYTWRZAH-OGFXRTJISA-N
MW219.33 g/mol
LogP2.06
Rot. Bonds3

About 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide

2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide (PubChem CID 175140576) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide.

Molecular Properties

Compound Name2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide
PubChem CID175140576
Molecular FormulaC8H13NO2S2
Molecular Weight219.33 g/mol
Exact Mass219.04
IUPAC Name2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide
SMILESCC[C@@H](C)Cc1nccs1.O=S=O
InChIInChI=1S/C8H13NS.O2S/c1-3-7(2)6-8-9-4-5-10-8;1-3-2/h4-5,7H,3,6H2,1-2H3;/t7-;/m1./s1
InChIKeyZZWFLGIYTWRZAH-OGFXRTJISA-N
XLogP2.06
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.33
LogP ≤ 52.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide?
The IUPAC name of 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide (CID 175140576) is 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide.
What is the SMILES notation for 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide?
The canonical SMILES for 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide is CC[C@@H](C)Cc1nccs1.O=S=O.
What is the InChIKey of 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide?
The InChIKey is ZZWFLGIYTWRZAH-OGFXRTJISA-N. The full InChI is InChI=1S/C8H13NS.O2S/c1-3-7(2)6-8-9-4-5-10-8;1-3-2/h4-5,7H,3,6H2,1-2H3;/t7-;/m1./s1.
What are the key properties of 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide?
2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide has a molecular weight of 219.33 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide is sourced from PubChem (CID 175140576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).