C8H13NO2S2 — CID 175140576
2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide (PubChem CID 175140576) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide.
| Compound Name | 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide |
|---|---|
| PubChem CID | 175140576 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-[(2R)-2-methylbutyl]-1,3-thiazole;sulfur dioxide |
| SMILES | CC[C@@H](C)Cc1nccs1.O=S=O |
| InChI | InChI=1S/C8H13NS.O2S/c1-3-7(2)6-8-9-4-5-10-8;1-3-2/h4-5,7H,3,6H2,1-2H3;/t7-;/m1./s1 |
| InChIKey | ZZWFLGIYTWRZAH-OGFXRTJISA-N |
| XLogP | 2.06 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |