C12H22N2S — CID 105015031
N-ethyl-4-methyl-1-(1,3-thiazol-2-yl)hexan-2-amine (PubChem CID 105015031) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N-ethyl-4-methyl-1-(1,3-thiazol-2-yl)hexan-2-amine.
| Compound Name | N-ethyl-4-methyl-1-(1,3-thiazol-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 105015031 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-ethyl-4-methyl-1-(1,3-thiazol-2-yl)hexan-2-amine |
| SMILES | CCNC(Cc1nccs1)CC(C)CC |
| InChI | InChI=1S/C12H22N2S/c1-4-10(3)8-11(13-5-2)9-12-14-6-7-15-12/h6-7,10-11,13H,4-5,8-9H2,1-3H3 |
| InChIKey | MXPYQKJIWAUJTD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |