C14H26N2S — CID 113429640
5-methyl-N-[2-(1,3-thiazol-2-yl)propyl]heptan-3-amine (PubChem CID 113429640) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 5-methyl-N-[2-(1,3-thiazol-2-yl)propyl]heptan-3-amine.
| Compound Name | 5-methyl-N-[2-(1,3-thiazol-2-yl)propyl]heptan-3-amine |
|---|---|
| PubChem CID | 113429640 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 5-methyl-N-[2-(1,3-thiazol-2-yl)propyl]heptan-3-amine |
| SMILES | CCC(C)CC(CC)NCC(C)c1nccs1 |
| InChI | InChI=1S/C14H26N2S/c1-5-11(3)9-13(6-2)16-10-12(4)14-15-7-8-17-14/h7-8,11-13,16H,5-6,9-10H2,1-4H3 |
| InChIKey | JBKQVHXPDHYDQH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |