C6H8BrNS — CID 66470662
2-(1-bromopropan-2-yl)-1,3-thiazole (PubChem CID 66470662) has the molecular formula C6H8BrNS and a molecular weight of 206.11 g/mol. Its IUPAC name is 2-(1-bromopropan-2-yl)-1,3-thiazole.
| Compound Name | 2-(1-bromopropan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 66470662 |
| Molecular Formula | C6H8BrNS |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | 2-(1-bromopropan-2-yl)-1,3-thiazole |
| SMILES | CC(CBr)c1nccs1 |
| InChI | InChI=1S/C6H8BrNS/c1-5(4-7)6-8-2-3-9-6/h2-3,5H,4H2,1H3 |
| InChIKey | KJCVOKPNHYXFHQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|