C7H11NS2 — CID 146833908
3-(1,3-thiazol-2-yl)butane-2-thiol (PubChem CID 146833908) has the molecular formula C7H11NS2 and a molecular weight of 173.31 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)butane-2-thiol.
| Compound Name | 3-(1,3-thiazol-2-yl)butane-2-thiol |
|---|---|
| PubChem CID | 146833908 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)butane-2-thiol |
| SMILES | CC(S)C(C)c1nccs1 |
| InChI | InChI=1S/C7H11NS2/c1-5(6(2)9)7-8-3-4-10-7/h3-6,9H,1-2H3 |
| InChIKey | SESXKDBVACLFLS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|