C8H9N3S2 — CID 63612751
N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 63612751) has the molecular formula C8H9N3S2 and a molecular weight of 211.32 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63612751 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CC(Nc1nccs1)c1nccs1 |
| InChI | InChI=1S/C8H9N3S2/c1-6(7-9-2-4-12-7)11-8-10-3-5-13-8/h2-6H,1H3,(H,10,11) |
| InChIKey | GKOTUXIMZSBNSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |