C7H8N2S — CID 114417967
N-but-3-yn-2-yl-1,3-thiazol-2-amine (PubChem CID 114417967) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-but-3-yn-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114417967 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | N-but-3-yn-2-yl-1,3-thiazol-2-amine |
| SMILES | C#CC(C)Nc1nccs1 |
| InChI | InChI=1S/C7H8N2S/c1-3-6(2)9-7-8-4-5-10-7/h1,4-6H,2H3,(H,8,9) |
| InChIKey | LIGQGIHPVHXQLD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|